TPCN03286
![[object Object]](../../static/browser_molecular_png/TPCN03286.png)
| Name | Methyl ester of the penianthic acid |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 |
| CAS Registry Number | 135650-39-4 |
| SMILES | COC(=O)C1(O)C=CCC2C3(C)CC(c4ccoc4)OC(=O)C3=CCC21C |
| Classify | Diterpenoids |
Content
| Family | Species | Part | Content (%) | Reference | DOI |
|---|---|---|---|---|---|
| Menispermaceae | Burasaia madagascarensis | Stems | 0.002000% | Planta Med 2002; 68: 377±379. | 10.1055/s-2002-26748 |
Properties
| HBA | 6 | HBD | 1 |
| HeavyAtoms | 27 | AlogP | 3.09 |
| TPSA | 85.97 | RotatableBonds | 2 |
| FractionCSP3 | 0.52 | Rings | 4 |
| AromaticRings | 1 | AliphaticRings | 3 |